C22H17F3N4O5 — CID 25095580
N-(4-nitrophenyl)-3-[4-nitro-3-(trifluoromethyl)anilino]-3-phenylpropanamide (PubChem CID 25095580) has the molecular formula C22H17F3N4O5 and a molecular weight of 474.40 g/mol. Its IUPAC name is N-(4-nitrophenyl)-3-[4-nitro-3-(trifluoromethyl)anilino]-3-phenylpropanamide.
| Compound Name | N-(4-nitrophenyl)-3-[4-nitro-3-(trifluoromethyl)anilino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 25095580 |
| Molecular Formula | C22H17F3N4O5 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-(4-nitrophenyl)-3-[4-nitro-3-(trifluoromethyl)anilino]-3-phenylpropanamide |
| SMILES | O=C(CC(Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)c1ccccc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H17F3N4O5/c23-22(24,25)18-12-16(8-11-20(18)29(33)34)26-19(14-4-2-1-3-5-14)13-21(30)27-15-6-9-17(10-7-15)28(31)32/h1-12,19,26H,13H2,(H,27,30) |
| InChIKey | DPSBFDYWMNXUEC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|