C22H18FN3O4 — CID 55363388
N-[3-(4-fluoro-3-nitroanilino)-3-oxo-1-phenylpropyl]benzamide (PubChem CID 55363388) has the molecular formula C22H18FN3O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is N-[3-(4-fluoro-3-nitroanilino)-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[3-(4-fluoro-3-nitroanilino)-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 55363388 |
| Molecular Formula | C22H18FN3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[3-(4-fluoro-3-nitroanilino)-3-oxo-1-phenylpropyl]benzamide |
| SMILES | O=C(CC(NC(=O)c1ccccc1)c1ccccc1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18FN3O4/c23-18-12-11-17(13-20(18)26(29)30)24-21(27)14-19(15-7-3-1-4-8-15)25-22(28)16-9-5-2-6-10-16/h1-13,19H,14H2,(H,24,27)(H,25,28) |
| InChIKey | OIECMQSULAKYJT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|