C20H24FN3O3 — CID 8645952
(2S)-N-(4-fluoro-3-nitrophenyl)-2-[[(1R)-3-methyl-1-phenylbutyl]amino]propanamide (PubChem CID 8645952) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is (2S)-N-(4-fluoro-3-nitrophenyl)-2-[[(1R)-3-methyl-1-phenylbutyl]amino]propanamide.
| Compound Name | (2S)-N-(4-fluoro-3-nitrophenyl)-2-[[(1R)-3-methyl-1-phenylbutyl]amino]propanamide |
|---|---|
| PubChem CID | 8645952 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (2S)-N-(4-fluoro-3-nitrophenyl)-2-[[(1R)-3-methyl-1-phenylbutyl]amino]propanamide |
| SMILES | CC(C)C[C@@H](N[C@@H](C)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C20H24FN3O3/c1-13(2)11-18(15-7-5-4-6-8-15)22-14(3)20(25)23-16-9-10-17(21)19(12-16)24(26)27/h4-10,12-14,18,22H,11H2,1-3H3,(H,23,25)/t14-,18+/m0/s1 |
| InChIKey | QWHBIPGCMKAFGQ-KBXCAEBGSA-N |
| XLogP | 4.44 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|