C21H27N3O4 — CID 8645964
(2R)-N-(2-methoxy-4-nitrophenyl)-2-[[(1S)-3-methyl-1-phenylbutyl]amino]propanamide (PubChem CID 8645964) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-4-nitrophenyl)-2-[[(1S)-3-methyl-1-phenylbutyl]amino]propanamide.
| Compound Name | (2R)-N-(2-methoxy-4-nitrophenyl)-2-[[(1S)-3-methyl-1-phenylbutyl]amino]propanamide |
|---|---|
| PubChem CID | 8645964 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2R)-N-(2-methoxy-4-nitrophenyl)-2-[[(1S)-3-methyl-1-phenylbutyl]amino]propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@@H](C)N[C@@H](CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O4/c1-14(2)12-19(16-8-6-5-7-9-16)22-15(3)21(25)23-18-11-10-17(24(26)27)13-20(18)28-4/h5-11,13-15,19,22H,12H2,1-4H3,(H,23,25)/t15-,19+/m1/s1 |
| InChIKey | ZSDXGMMYRZZCRT-BEFAXECRSA-N |
| XLogP | 4.31 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|