C23H22N4O4S — CID 3770997
1-(3,3-diphenylpropanoylamino)-3-(2-methoxy-4-nitrophenyl)thiourea (PubChem CID 3770997) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 1-(3,3-diphenylpropanoylamino)-3-(2-methoxy-4-nitrophenyl)thiourea.
| Compound Name | 1-(3,3-diphenylpropanoylamino)-3-(2-methoxy-4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 3770997 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-(3,3-diphenylpropanoylamino)-3-(2-methoxy-4-nitrophenyl)thiourea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=S)NNC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N4O4S/c1-31-21-14-18(27(29)30)12-13-20(21)24-23(32)26-25-22(28)15-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,19H,15H2,1H3,(H,25,28)(H2,24,26,32) |
| InChIKey | LMJYBGQAUKHJOX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|