C18H17N5O4S — CID 3836810
1-(2-methoxy-4-nitrophenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea (PubChem CID 3836810) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-(2-methoxy-4-nitrophenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea.
| Compound Name | 1-(2-methoxy-4-nitrophenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 3836810 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-(2-methoxy-4-nitrophenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=S)NNC(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C18H17N5O4S/c1-22-10-13(12-5-3-4-6-15(12)22)17(24)20-21-18(28)19-14-8-7-11(23(25)26)9-16(14)27-2/h3-10H,1-2H3,(H,20,24)(H2,19,21,28) |
| InChIKey | PDYFLISVUNACEA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|