C20H25FN3O3+ — CID 8645949
[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]-[(1S)-3-methyl-1-phenylbutyl]azanium (PubChem CID 8645949) has the molecular formula C20H25FN3O3+ and a molecular weight of 374.44 g/mol. Its IUPAC name is [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]-[(1S)-3-methyl-1-phenylbutyl]azanium.
| Compound Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]-[(1S)-3-methyl-1-phenylbutyl]azanium |
|---|---|
| PubChem CID | 8645949 |
| Molecular Formula | C20H25FN3O3+ |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]-[(1S)-3-methyl-1-phenylbutyl]azanium |
| SMILES | CC(C)C[C@H]([NH2+][C@@H](C)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C20H24FN3O3/c1-13(2)11-18(15-7-5-4-6-8-15)22-14(3)20(25)23-16-9-10-17(21)19(12-16)24(26)27/h4-10,12-14,18,22H,11H2,1-3H3,(H,23,25)/p+1/t14-,18-/m0/s1 |
| InChIKey | QWHBIPGCMKAFGQ-KSSFIOAISA-O |
| XLogP | 3.41 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|