C16H13FN2O6 — CID 7798013
[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-hydroxybenzoate (PubChem CID 7798013) has the molecular formula C16H13FN2O6 and a molecular weight of 348.29 g/mol. Its IUPAC name is [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-hydroxybenzoate.
| Compound Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 7798013 |
| Molecular Formula | C16H13FN2O6 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-hydroxybenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1O)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13FN2O6/c1-9(25-16(22)11-4-2-3-5-14(11)20)15(21)18-10-6-7-12(17)13(8-10)19(23)24/h2-9,20H,1H3,(H,18,21)/t9-/m0/s1 |
| InChIKey | QITJKZAXAXOAQM-VIFPVBQESA-N |
| XLogP | 2.62 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|