C18H13BrFN3O5 — CID 55703826
[1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 3-bromo-1H-indole-2-carboxylate (PubChem CID 55703826) has the molecular formula C18H13BrFN3O5 and a molecular weight of 450.22 g/mol. Its IUPAC name is [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 3-bromo-1H-indole-2-carboxylate.
| Compound Name | [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 3-bromo-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 55703826 |
| Molecular Formula | C18H13BrFN3O5 |
| Molecular Weight | 450.22 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | [1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 3-bromo-1H-indole-2-carboxylate |
| SMILES | CC(OC(=O)c1[nH]c2ccccc2c1Br)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13BrFN3O5/c1-9(17(24)21-10-6-7-12(20)14(8-10)23(26)27)28-18(25)16-15(19)11-4-2-3-5-13(11)22-16/h2-9,22H,1H3,(H,21,24) |
| InChIKey | VMZIMCPCTPUHON-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|