C18H14ClN3O5 — CID 55704015
[1-(2-nitroanilino)-1-oxopropan-2-yl] 3-chloro-1H-indole-2-carboxylate (PubChem CID 55704015) has the molecular formula C18H14ClN3O5 and a molecular weight of 387.78 g/mol. Its IUPAC name is [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-chloro-1H-indole-2-carboxylate.
| Compound Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 55704015 |
| Molecular Formula | C18H14ClN3O5 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-chloro-1H-indole-2-carboxylate |
| SMILES | CC(OC(=O)c1[nH]c2ccccc2c1Cl)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14ClN3O5/c1-10(17(23)21-13-8-4-5-9-14(13)22(25)26)27-18(24)16-15(19)11-6-2-3-7-12(11)20-16/h2-10,20H,1H3,(H,21,23) |
| InChIKey | FUFRWLBGGLFJTL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|