C17H14N4O5 — CID 7372635
[(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 1H-indazole-3-carboxylate (PubChem CID 7372635) has the molecular formula C17H14N4O5 and a molecular weight of 354.32 g/mol. Its IUPAC name is [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 1H-indazole-3-carboxylate.
| Compound Name | [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 7372635 |
| Molecular Formula | C17H14N4O5 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [(2S)-1-(2-nitroanilino)-1-oxopropan-2-yl] 1H-indazole-3-carboxylate |
| SMILES | C[C@H](OC(=O)c1n[nH]c2ccccc12)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N4O5/c1-10(16(22)18-13-8-4-5-9-14(13)21(24)25)26-17(23)15-11-6-2-3-7-12(11)19-20-15/h2-10H,1H3,(H,18,22)(H,19,20)/t10-/m0/s1 |
| InChIKey | ZRLXKBZYHIGTPK-JTQLQIEISA-N |
| XLogP | 2.66 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|