C21H25FN3O3+ — CID 8859131
[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]azanium (PubChem CID 8859131) has the molecular formula C21H25FN3O3+ and a molecular weight of 386.45 g/mol. Its IUPAC name is [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]azanium.
| Compound Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8859131 |
| Molecular Formula | C21H25FN3O3+ |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+][C@H](C)c1ccc2c(c1)CCCC2)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24FN3O3/c1-13(16-8-7-15-5-3-4-6-17(15)11-16)23-14(2)21(26)24-18-9-10-19(22)20(12-18)25(27)28/h7-14,23H,3-6H2,1-2H3,(H,24,26)/p+1/t13-,14+/m1/s1 |
| InChIKey | OMCPMGAMQYSIQZ-KGLIPLIRSA-O |
| XLogP | 3.26 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|