C17H25FN3O3+ — CID 11939562
[(1R,2R,3S)-2,3-dimethylcyclohexyl]-[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]azanium (PubChem CID 11939562) has the molecular formula C17H25FN3O3+ and a molecular weight of 338.40 g/mol. Its IUPAC name is [(1R,2R,3S)-2,3-dimethylcyclohexyl]-[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(1R,2R,3S)-2,3-dimethylcyclohexyl]-[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 11939562 |
| Molecular Formula | C17H25FN3O3+ |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [(1R,2R,3S)-2,3-dimethylcyclohexyl]-[(2S)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl]azanium |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1[NH2+][C@@H](C)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H24FN3O3/c1-10-5-4-6-15(11(10)2)19-12(3)17(22)20-13-7-8-14(18)16(9-13)21(23)24/h7-12,15,19H,4-6H2,1-3H3,(H,20,22)/p+1/t10-,11+,12-,15+/m0/s1 |
| InChIKey | DVKBLWLQTNGERO-OZTPJHRESA-O |
| XLogP | 2.45 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|