C23H19IN4O5 — CID 137127393
N-[(1S)-3-[(2Z)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 137127393) has the molecular formula C23H19IN4O5 and a molecular weight of 558.33 g/mol. Its IUPAC name is N-[(1S)-3-[(2Z)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[(1S)-3-[(2Z)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 137127393 |
| Molecular Formula | C23H19IN4O5 |
| Molecular Weight | 558.33 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | N-[(1S)-3-[(2Z)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]hydrazinyl]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | O=C(C[C@H](NC(=O)c1ccccc1)c1ccccc1)N/N=C\c1cc(I)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H19IN4O5/c24-18-11-15(12-20(22(18)30)28(32)33)14-25-27-21(29)13-19(16-7-3-1-4-8-16)26-23(31)17-9-5-2-6-10-17/h1-12,14,19,30H,13H2,(H,26,31)(H,27,29)/b25-14-/t19-/m0/s1 |
| InChIKey | FMKNPQQNIZCLDK-ILRHRSLTSA-N |
| XLogP | 3.92 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|