C21H19N3O3 — CID 7032038
N-[(1R)-3-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 7032038) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[(1R)-3-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[(1R)-3-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 7032038 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[(1R)-3-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | O=C(C[C@@H](NC(=O)c1ccccc1)c1ccccc1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C21H19N3O3/c25-20(24-22-15-18-12-7-13-27-18)14-19(16-8-3-1-4-9-16)23-21(26)17-10-5-2-6-11-17/h1-13,15,19H,14H2,(H,23,26)(H,24,25)/b22-15-/t19-/m1/s1 |
| InChIKey | GKGAJUGXNJROTA-MLPWYGTASA-N |
| XLogP | 3.29 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|