C16H14N4O5 — CID 135684451
N-[2-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 135684451) has the molecular formula C16H14N4O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is N-[2-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 135684451 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[2-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)N/N=C/c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14N4O5/c21-14-7-6-11(8-13(14)20(24)25)9-18-19-15(22)10-17-16(23)12-4-2-1-3-5-12/h1-9,21H,10H2,(H,17,23)(H,19,22)/b18-9+ |
| InChIKey | WRMUBMMZZLLFCG-GIJQJNRQSA-N |
| XLogP | 1.18 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|