C16H13FN4O5 — CID 135821567
N-(2-fluorophenyl)-N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanediamide (PubChem CID 135821567) has the molecular formula C16H13FN4O5 and a molecular weight of 360.30 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanediamide.
| Compound Name | N-(2-fluorophenyl)-N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 135821567 |
| Molecular Formula | C16H13FN4O5 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(2-fluorophenyl)-N'-[(E)-(4-hydroxy-3-nitrophenyl)methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)Nc1ccccc1F)N/N=C/c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13FN4O5/c17-11-3-1-2-4-12(11)19-15(23)8-16(24)20-18-9-10-5-6-14(22)13(7-10)21(25)26/h1-7,9,22H,8H2,(H,19,23)(H,20,24)/b18-9+ |
| InChIKey | CHUOCUWCIMSVBY-GIJQJNRQSA-N |
| XLogP | 1.92 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|