C18H16N4O7 — CID 136870213
N-[2-[(2Z)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 136870213) has the molecular formula C18H16N4O7 and a molecular weight of 400.35 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[2-[(2Z)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 136870213 |
| Molecular Formula | C18H16N4O7 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[2-[(2Z)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCCO2)N/N=C\c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N4O7/c23-14-3-1-11(7-13(14)22(26)27)9-20-21-17(24)10-19-18(25)12-2-4-15-16(8-12)29-6-5-28-15/h1-4,7-9,23H,5-6,10H2,(H,19,25)(H,21,24)/b20-9- |
| InChIKey | AWPCTCYOJLJZLJ-UKWGHVSLSA-N |
| XLogP | 0.95 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|