C19H19N3O6 — CID 2246597
N-[2-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 2246597) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-[2-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[2-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 2246597 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[2-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | COc1cc(C=NNC(=O)CNC(=O)c2ccc3c(c2)OCCO3)ccc1O |
| InChI | InChI=1S/C19H19N3O6/c1-26-16-8-12(2-4-14(16)23)10-21-22-18(24)11-20-19(25)13-3-5-15-17(9-13)28-7-6-27-15/h2-5,8-10,23H,6-7,11H2,1H3,(H,20,25)(H,22,24) |
| InChIKey | LHGGPGKLVFAHPC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|