C22H23N3O8 — CID 6080791
ethyl 2-[4-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 6080791) has the molecular formula C22H23N3O8 and a molecular weight of 457.44 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 6080791 |
| Molecular Formula | C22H23N3O8 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | ethyl 2-[4-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=N\NC(=O)CNC(=O)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C22H23N3O8/c1-3-30-21(27)12-31-16-6-4-14(8-18(16)29-2)10-24-25-20(26)11-23-22(28)15-5-7-17-19(9-15)33-13-32-17/h4-10H,3,11-13H2,1-2H3,(H,23,28)(H,25,26)/b24-10- |
| InChIKey | NEQFEBQVJHJOJX-VROXFSQNSA-N |
| XLogP | 1.25 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|