C18H14N3O6- — CID 4178970
4-[[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 4178970) has the molecular formula C18H14N3O6- and a molecular weight of 368.33 g/mol. Its IUPAC name is 4-[[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 4-[[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4178970 |
| Molecular Formula | C18H14N3O6- |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-[[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)NN=Cc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N3O6/c22-16(21-20-8-11-1-3-12(4-2-11)18(24)25)9-19-17(23)13-5-6-14-15(7-13)27-10-26-14/h1-8H,9-10H2,(H,19,23)(H,21,22)(H,24,25)/p-1 |
| InChIKey | LMABJUNHXLFCQB-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|