C24H20N4O7 — CID 3454071
N-[2-[2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3454071) has the molecular formula C24H20N4O7 and a molecular weight of 476.45 g/mol. Its IUPAC name is N-[2-[2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3454071 |
| Molecular Formula | C24H20N4O7 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[2-[2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)NN=Cc1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H20N4O7/c29-23(13-25-24(30)18-5-10-21-22(11-18)35-15-34-21)27-26-12-16-3-8-20(9-4-16)33-14-17-1-6-19(7-2-17)28(31)32/h1-12H,13-15H2,(H,25,30)(H,27,29) |
| InChIKey | GOMOOMQRLSTEAC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|