C23H18IN3O7 — CID 4988714
N-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 4988714) has the molecular formula C23H18IN3O7 and a molecular weight of 575.32 g/mol. Its IUPAC name is N-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4988714 |
| Molecular Formula | C23H18IN3O7 |
| Molecular Weight | 575.32 g/mol |
| Exact Mass | 575.02 |
| IUPAC Name | N-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc3c(c2)OCO3)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18IN3O7/c1-31-21-9-15(11-25-26-23(28)16-4-7-19-20(10-16)34-13-33-19)8-18(24)22(21)32-12-14-2-5-17(6-3-14)27(29)30/h2-11H,12-13H2,1H3,(H,26,28) |
| InChIKey | OPHXCDLAOQNYJP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|