C21H23N3O4 — CID 3988496
N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-4-tert-butylbenzamide (PubChem CID 3988496) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-4-tert-butylbenzamide.
| Compound Name | N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 3988496 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)NN=Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-21(2,3)16-7-5-15(6-8-16)20(26)22-12-19(25)24-23-11-14-4-9-17-18(10-14)28-13-27-17/h4-11H,12-13H2,1-3H3,(H,22,26)(H,24,25) |
| InChIKey | MZSZECWIKSLXKX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|