C18H16BrN3O5 — CID 2867403
N-[2-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 2867403) has the molecular formula C18H16BrN3O5 and a molecular weight of 434.25 g/mol. Its IUPAC name is N-[2-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[2-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 2867403 |
| Molecular Formula | C18H16BrN3O5 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | N-[2-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCCO2)NN=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C18H16BrN3O5/c19-13-2-3-14(23)12(7-13)9-21-22-17(24)10-20-18(25)11-1-4-15-16(8-11)27-6-5-26-15/h1-4,7-9,23H,5-6,10H2,(H,20,25)(H,22,24) |
| InChIKey | AFPOWNKCDGEAEQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|