C16H14N4O6S — CID 4023751
N-[2-[2-[(5-nitrothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 4023751) has the molecular formula C16H14N4O6S and a molecular weight of 390.38 g/mol. Its IUPAC name is N-[2-[2-[(5-nitrothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[2-[2-[(5-nitrothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 4023751 |
| Molecular Formula | C16H14N4O6S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[2-[2-[(5-nitrothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCCO2)NN=Cc1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H14N4O6S/c21-14(19-18-8-11-2-4-15(27-11)20(23)24)9-17-16(22)10-1-3-12-13(7-10)26-6-5-25-12/h1-4,7-8H,5-6,9H2,(H,17,22)(H,19,21) |
| InChIKey | XVYBWZGUVHFJMF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|