C12H9N3O4S — CID 5406594
4-hydroxy-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 5406594) has the molecular formula C12H9N3O4S and a molecular weight of 291.29 g/mol. Its IUPAC name is 4-hydroxy-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-hydroxy-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5406594 |
| Molecular Formula | C12H9N3O4S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 4-hydroxy-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc([N+](=O)[O-])s1)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H9N3O4S/c16-9-3-1-8(2-4-9)12(17)14-13-7-10-5-6-11(20-10)15(18)19/h1-7,16H,(H,14,17)/b13-7- |
| InChIKey | XCUXNHDTDOSFAI-QPEQYQDCSA-N |
| XLogP | 2.13 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|