C22H18N4O7 — CID 3940374
N-[2-[2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3940374) has the molecular formula C22H18N4O7 and a molecular weight of 450.41 g/mol. Its IUPAC name is N-[2-[2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3940374 |
| Molecular Formula | C22H18N4O7 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[2-[2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1c(-c2ccc(C=NNC(=O)CNC(=O)c3ccc4c(c3)OCO4)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18N4O7/c1-13-16(3-2-4-17(13)26(29)30)18-8-6-15(33-18)10-24-25-21(27)11-23-22(28)14-5-7-19-20(9-14)32-12-31-19/h2-10H,11-12H2,1H3,(H,23,28)(H,25,27) |
| InChIKey | BWCKIFNHWPSQQP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|