C21H17FN4O5 — CID 126176600
2-fluoro-N-[2-[(2Z)-2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 126176600) has the molecular formula C21H17FN4O5 and a molecular weight of 424.39 g/mol. Its IUPAC name is 2-fluoro-N-[2-[(2Z)-2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[(2Z)-2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 126176600 |
| Molecular Formula | C21H17FN4O5 |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-fluoro-N-[2-[(2Z)-2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | Cc1c(-c2ccc(/C=N\NC(=O)CNC(=O)c3ccccc3F)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17FN4O5/c1-13-15(6-4-8-18(13)26(29)30)19-10-9-14(31-19)11-24-25-20(27)12-23-21(28)16-5-2-3-7-17(16)22/h2-11H,12H2,1H3,(H,23,28)(H,25,27)/b24-11- |
| InChIKey | VGZMSCYZFOZHRE-MYKKPKGFSA-N |
| XLogP | 3.18 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|