C22H18Cl2N4O6 — CID 126171343
2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-[(Z)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 126171343) has the molecular formula C22H18Cl2N4O6 and a molecular weight of 505.31 g/mol. Its IUPAC name is 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-[(Z)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-[(Z)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126171343 |
| Molecular Formula | C22H18Cl2N4O6 |
| Molecular Weight | 505.31 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-N-[(Z)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | Cc1c(-c2ccc(/C=N\NC(=O)CNC(=O)COc3ccc(Cl)cc3Cl)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18Cl2N4O6/c1-13-16(3-2-4-18(13)28(31)32)19-8-6-15(34-19)10-26-27-21(29)11-25-22(30)12-33-20-7-5-14(23)9-17(20)24/h2-10H,11-12H2,1H3,(H,25,30)(H,27,29)/b26-10- |
| InChIKey | RWRPSDQQAXENRA-KALUYTGESA-N |
| XLogP | 4.12 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|