C21H18BrN3O5S — CID 50740445
3-[(4-bromophenyl)sulfonylamino]-N-(4-nitrophenyl)-3-phenylpropanamide (PubChem CID 50740445) has the molecular formula C21H18BrN3O5S and a molecular weight of 504.36 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-(4-nitrophenyl)-3-phenylpropanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-(4-nitrophenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 50740445 |
| Molecular Formula | C21H18BrN3O5S |
| Molecular Weight | 504.36 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-(4-nitrophenyl)-3-phenylpropanamide |
| SMILES | O=C(CC(NS(=O)(=O)c1ccc(Br)cc1)c1ccccc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18BrN3O5S/c22-16-6-12-19(13-7-16)31(29,30)24-20(15-4-2-1-3-5-15)14-21(26)23-17-8-10-18(11-9-17)25(27)28/h1-13,20,24H,14H2,(H,23,26) |
| InChIKey | URYAYOXEJZNJQQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|