C19H16BrN3O4 — CID 25095327
N-(4-bromophenyl)-3-(furan-2-yl)-3-(4-nitroanilino)propanamide (PubChem CID 25095327) has the molecular formula C19H16BrN3O4 and a molecular weight of 430.26 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-(furan-2-yl)-3-(4-nitroanilino)propanamide.
| Compound Name | N-(4-bromophenyl)-3-(furan-2-yl)-3-(4-nitroanilino)propanamide |
|---|---|
| PubChem CID | 25095327 |
| Molecular Formula | C19H16BrN3O4 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | N-(4-bromophenyl)-3-(furan-2-yl)-3-(4-nitroanilino)propanamide |
| SMILES | O=C(CC(Nc1ccc([N+](=O)[O-])cc1)c1ccco1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H16BrN3O4/c20-13-3-5-15(6-4-13)22-19(24)12-17(18-2-1-11-27-18)21-14-7-9-16(10-8-14)23(25)26/h1-11,17,21H,12H2,(H,22,24) |
| InChIKey | DQWAFACGKPYHJZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|