C21H16N4O6 — CID 3396330
N,N'-bis(4-nitrophenyl)-2-phenylpropanediamide (PubChem CID 3396330) has the molecular formula C21H16N4O6 and a molecular weight of 420.38 g/mol. Its IUPAC name is N,N'-bis(4-nitrophenyl)-2-phenylpropanediamide.
| Compound Name | N,N'-bis(4-nitrophenyl)-2-phenylpropanediamide |
|---|---|
| PubChem CID | 3396330 |
| Molecular Formula | C21H16N4O6 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N,N'-bis(4-nitrophenyl)-2-phenylpropanediamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C(C(=O)Nc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N4O6/c26-20(22-15-6-10-17(11-7-15)24(28)29)19(14-4-2-1-3-5-14)21(27)23-16-8-12-18(13-9-16)25(30)31/h1-13,19H,(H,22,26)(H,23,27) |
| InChIKey | HTVOTKJKUKFDCH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|