C15H13N3O4S — CID 175604373
(2S)-2-[(4-nitrophenyl)carbamothioylamino]-2-phenylacetic acid (PubChem CID 175604373) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is (2S)-2-[(4-nitrophenyl)carbamothioylamino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(4-nitrophenyl)carbamothioylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 175604373 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (2S)-2-[(4-nitrophenyl)carbamothioylamino]-2-phenylacetic acid |
| SMILES | O=C(O)[C@@H](NC(=S)Nc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C15H13N3O4S/c19-14(20)13(10-4-2-1-3-5-10)17-15(23)16-11-6-8-12(9-7-11)18(21)22/h1-9,13H,(H,19,20)(H2,16,17,23)/t13-/m0/s1 |
| InChIKey | JCDDLWHYFXBHPJ-ZDUSSCGKSA-N |
| XLogP | 2.71 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|