C23H19Cl3N4O3S — CID 2830341
2,2-diphenyl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 2830341) has the molecular formula C23H19Cl3N4O3S and a molecular weight of 537.86 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 2830341 |
| Molecular Formula | C23H19Cl3N4O3S |
| Molecular Weight | 537.86 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2,2-diphenyl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | O=C(NC(NC(=S)Nc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19Cl3N4O3S/c24-23(25,26)21(29-22(34)27-17-11-13-18(14-12-17)30(32)33)28-20(31)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,19,21H,(H,28,31)(H2,27,29,34) |
| InChIKey | TVPDYDPUADCEFO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.86 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|