C16H13Cl3N6O7S2 — CID 5057243
3,5-dinitro-N-[2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 5057243) has the molecular formula C16H13Cl3N6O7S2 and a molecular weight of 571.81 g/mol. Its IUPAC name is 3,5-dinitro-N-[2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3,5-dinitro-N-[2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 5057243 |
| Molecular Formula | C16H13Cl3N6O7S2 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 569.94 |
| IUPAC Name | 3,5-dinitro-N-[2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NC(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H13Cl3N6O7S2/c17-16(18,19)14(23-15(33)21-9-1-3-12(4-2-9)34(20,31)32)22-13(26)8-5-10(24(27)28)7-11(6-8)25(29)30/h1-7,14H,(H,22,26)(H2,20,31,32)(H2,21,23,33) |
| InChIKey | DOMCYMHNIUBUMX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 199.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|