C15H13N3O6S — CID 135052001
N'-(benzenesulfonyl)-N-(4-nitrophenyl)propanediamide (PubChem CID 135052001) has the molecular formula C15H13N3O6S and a molecular weight of 363.35 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-(4-nitrophenyl)propanediamide.
| Compound Name | N'-(benzenesulfonyl)-N-(4-nitrophenyl)propanediamide |
|---|---|
| PubChem CID | 135052001 |
| Molecular Formula | C15H13N3O6S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N'-(benzenesulfonyl)-N-(4-nitrophenyl)propanediamide |
| SMILES | O=C(CC(=O)NS(=O)(=O)c1ccccc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H13N3O6S/c19-14(16-11-6-8-12(9-7-11)18(21)22)10-15(20)17-25(23,24)13-4-2-1-3-5-13/h1-9H,10H2,(H,16,19)(H,17,20) |
| InChIKey | DKLQEVJDDOYDQQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|