C16H16BrNO4S — CID 50739470
methyl 3-[(4-bromophenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 50739470) has the molecular formula C16H16BrNO4S and a molecular weight of 398.28 g/mol. Its IUPAC name is methyl 3-[(4-bromophenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | methyl 3-[(4-bromophenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 50739470 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | methyl 3-[(4-bromophenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NS(=O)(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H16BrNO4S/c1-22-16(19)11-15(12-5-3-2-4-6-12)18-23(20,21)14-9-7-13(17)8-10-14/h2-10,15,18H,11H2,1H3 |
| InChIKey | BHSDDIRIGYBJTL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |