C14H14BrNO4S2 — CID 7095151
methyl (3R)-3-(4-bromophenyl)-3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 7095151) has the molecular formula C14H14BrNO4S2 and a molecular weight of 404.31 g/mol. Its IUPAC name is methyl (3R)-3-(4-bromophenyl)-3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | methyl (3R)-3-(4-bromophenyl)-3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7095151 |
| Molecular Formula | C14H14BrNO4S2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | methyl (3R)-3-(4-bromophenyl)-3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | COC(=O)C[C@@H](NS(=O)(=O)c1cccs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H14BrNO4S2/c1-20-13(17)9-12(10-4-6-11(15)7-5-10)16-22(18,19)14-3-2-8-21-14/h2-8,12,16H,9H2,1H3/t12-/m1/s1 |
| InChIKey | LHDGIPPTFDCIJO-GFCCVEGCSA-N |
| XLogP | 3.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |