C18H23NO4S3 — CID 102255642
S-tert-butyl (3R)-3-(4-methoxyphenyl)-3-(thiophen-2-ylsulfonylamino)propanethioate (PubChem CID 102255642) has the molecular formula C18H23NO4S3 and a molecular weight of 413.59 g/mol. Its IUPAC name is S-tert-butyl (3R)-3-(4-methoxyphenyl)-3-(thiophen-2-ylsulfonylamino)propanethioate.
| Compound Name | S-tert-butyl (3R)-3-(4-methoxyphenyl)-3-(thiophen-2-ylsulfonylamino)propanethioate |
|---|---|
| PubChem CID | 102255642 |
| Molecular Formula | C18H23NO4S3 |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | S-tert-butyl (3R)-3-(4-methoxyphenyl)-3-(thiophen-2-ylsulfonylamino)propanethioate |
| SMILES | COc1ccc([C@@H](CC(=O)SC(C)(C)C)NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H23NO4S3/c1-18(2,3)25-16(20)12-15(13-7-9-14(23-4)10-8-13)19-26(21,22)17-6-5-11-24-17/h5-11,15,19H,12H2,1-4H3/t15-/m1/s1 |
| InChIKey | PMECZJDLWYHNBY-OAHLLOKOSA-N |
| XLogP | 4.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|