C23H26N2O4S2 — CID 92674510
N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 92674510) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 92674510 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | COc1ccc([C@H](CC(C)C)NC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C23H26N2O4S2/c1-16(2)15-21(17-8-12-20(29-3)13-9-17)24-23(26)18-6-10-19(11-7-18)25-31(27,28)22-5-4-14-30-22/h4-14,16,21,25H,15H2,1-3H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | YAQCBVVSZCEEAC-NRFANRHFSA-N |
| XLogP | 5.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |