C19H26N2O3S2 — CID 46515976
N-(6-methylheptan-2-yl)-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 46515976) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(6-methylheptan-2-yl)-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 46515976 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(6-methylheptan-2-yl)-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CC(C)CCCC(C)NC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H26N2O3S2/c1-14(2)6-4-7-15(3)20-19(22)16-9-11-17(12-10-16)21-26(23,24)18-8-5-13-25-18/h5,8-15,21H,4,6-7H2,1-3H3,(H,20,22) |
| InChIKey | FKJYGPVFJYOMMT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |