C14H17NO3S2 — CID 64645996
1-(4-methoxyphenyl)-N-methyl-2-thiophen-2-ylsulfonylethanamine (PubChem CID 64645996) has the molecular formula C14H17NO3S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-methyl-2-thiophen-2-ylsulfonylethanamine.
| Compound Name | 1-(4-methoxyphenyl)-N-methyl-2-thiophen-2-ylsulfonylethanamine |
|---|---|
| PubChem CID | 64645996 |
| Molecular Formula | C14H17NO3S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-methyl-2-thiophen-2-ylsulfonylethanamine |
| SMILES | CNC(CS(=O)(=O)c1cccs1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H17NO3S2/c1-15-13(11-5-7-12(18-2)8-6-11)10-20(16,17)14-4-3-9-19-14/h3-9,13,15H,10H2,1-2H3 |
| InChIKey | CBNDSWIPEHWVRC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |