C13H21NO5S2 — CID 64646603
1-(4-methoxyphenyl)-N-methyl-2-(2-methylsulfonylethylsulfonyl)ethanamine (PubChem CID 64646603) has the molecular formula C13H21NO5S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-methyl-2-(2-methylsulfonylethylsulfonyl)ethanamine.
| Compound Name | 1-(4-methoxyphenyl)-N-methyl-2-(2-methylsulfonylethylsulfonyl)ethanamine |
|---|---|
| PubChem CID | 64646603 |
| Molecular Formula | C13H21NO5S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-methyl-2-(2-methylsulfonylethylsulfonyl)ethanamine |
| SMILES | CNC(CS(=O)(=O)CCS(C)(=O)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H21NO5S2/c1-14-13(11-4-6-12(19-2)7-5-11)10-21(17,18)9-8-20(3,15)16/h4-7,13-14H,8-10H2,1-3H3 |
| InChIKey | ZIOBNLGMVXNEAN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |