C14H23NO4S2 — CID 64644621
N-ethyl-1-(4-methylphenyl)-2-(2-methylsulfonylethylsulfonyl)ethanamine (PubChem CID 64644621) has the molecular formula C14H23NO4S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-ethyl-1-(4-methylphenyl)-2-(2-methylsulfonylethylsulfonyl)ethanamine.
| Compound Name | N-ethyl-1-(4-methylphenyl)-2-(2-methylsulfonylethylsulfonyl)ethanamine |
|---|---|
| PubChem CID | 64644621 |
| Molecular Formula | C14H23NO4S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-ethyl-1-(4-methylphenyl)-2-(2-methylsulfonylethylsulfonyl)ethanamine |
| SMILES | CCNC(CS(=O)(=O)CCS(C)(=O)=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H23NO4S2/c1-4-15-14(13-7-5-12(2)6-8-13)11-21(18,19)10-9-20(3,16)17/h5-8,14-15H,4,9-11H2,1-3H3 |
| InChIKey | CNISLUDVYOPPQX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |