C13H21NO4S2 — CID 64646605
N-ethyl-2-(2-methylsulfonylethylsulfonyl)-1-phenylethanamine (PubChem CID 64646605) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-ethyl-2-(2-methylsulfonylethylsulfonyl)-1-phenylethanamine.
| Compound Name | N-ethyl-2-(2-methylsulfonylethylsulfonyl)-1-phenylethanamine |
|---|---|
| PubChem CID | 64646605 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-ethyl-2-(2-methylsulfonylethylsulfonyl)-1-phenylethanamine |
| SMILES | CCNC(CS(=O)(=O)CCS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C13H21NO4S2/c1-3-14-13(12-7-5-4-6-8-12)11-20(17,18)10-9-19(2,15)16/h4-8,13-14H,3,9-11H2,1-2H3 |
| InChIKey | UOFXVMJGLPXRHP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |