C16H27NO2S — CID 106732316
N-ethyl-1-phenyl-5-propan-2-ylsulfonylpentan-1-amine (PubChem CID 106732316) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is N-ethyl-1-phenyl-5-propan-2-ylsulfonylpentan-1-amine.
| Compound Name | N-ethyl-1-phenyl-5-propan-2-ylsulfonylpentan-1-amine |
|---|---|
| PubChem CID | 106732316 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-ethyl-1-phenyl-5-propan-2-ylsulfonylpentan-1-amine |
| SMILES | CCNC(CCCCS(=O)(=O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H27NO2S/c1-4-17-16(15-10-6-5-7-11-15)12-8-9-13-20(18,19)14(2)3/h5-7,10-11,14,16-17H,4,8-9,12-13H2,1-3H3 |
| InChIKey | AYKVBZMOUGLNLK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|