C11H14F3NO2S — CID 75443631
2,2,2-trifluoro-N-(2-methylsulfonyl-1-phenylethyl)ethanamine (PubChem CID 75443631) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-methylsulfonyl-1-phenylethyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-N-(2-methylsulfonyl-1-phenylethyl)ethanamine |
|---|---|
| PubChem CID | 75443631 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-methylsulfonyl-1-phenylethyl)ethanamine |
| SMILES | CS(=O)(=O)CC(NCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-18(16,17)7-10(15-8-11(12,13)14)9-5-3-2-4-6-9/h2-6,10,15H,7-8H2,1H3 |
| InChIKey | RGQXNCIVOYWNHV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |