C13H19F3N2O2S — CID 106334344
N-ethyl-2-[(3,3,3-trifluoro-1-phenylpropyl)amino]ethanesulfonamide (PubChem CID 106334344) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is N-ethyl-2-[(3,3,3-trifluoro-1-phenylpropyl)amino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[(3,3,3-trifluoro-1-phenylpropyl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106334344 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-ethyl-2-[(3,3,3-trifluoro-1-phenylpropyl)amino]ethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNC(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H19F3N2O2S/c1-2-18-21(19,20)9-8-17-12(10-13(14,15)16)11-6-4-3-5-7-11/h3-7,12,17-18H,2,8-10H2,1H3 |
| InChIKey | CMHLIDGEXKMVLZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |