C14H23ClN2O2S — CID 103901960
2-[1-(4-chlorophenyl)butylamino]-N-ethylethanesulfonamide (PubChem CID 103901960) has the molecular formula C14H23ClN2O2S and a molecular weight of 318.87 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)butylamino]-N-ethylethanesulfonamide.
| Compound Name | 2-[1-(4-chlorophenyl)butylamino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 103901960 |
| Molecular Formula | C14H23ClN2O2S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[1-(4-chlorophenyl)butylamino]-N-ethylethanesulfonamide |
| SMILES | CCCC(NCCS(=O)(=O)NCC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H23ClN2O2S/c1-3-5-14(12-6-8-13(15)9-7-12)16-10-11-20(18,19)17-4-2/h6-9,14,16-17H,3-5,10-11H2,1-2H3 |
| InChIKey | ONBLRLYZZWPCRP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |